EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H82O19 |
| Net Charge | 0 |
| Average Mass | 963.165 |
| Monoisotopic Mass | 962.54503 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3([H])[C@]1(C)[C@H](O)C[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(C)(C)O |
| InChI | InChI=1S/C48H82O19/c1-21(9-13-31(45(4,5)61)66-43-40(37(58)34(55)27(20-51)64-43)67-42-39(60)36(57)33(54)26(19-50)63-42)22-15-16-46(6)28-12-10-23-24(48(28,8)29(52)17-47(22,46)7)11-14-30(44(23,2)3)65-41-38(59)35(56)32(53)25(18-49)62-41/h10,21-22,24-43,49-61H,9,11-20H2,1-8H3/t21-,22-,24-,25-,26-,27-,28+,29-,30+,31-,32-,33-,34-,35+,36+,37+,38-,39-,40-,41+,42+,43+,46+,47-,48+/m1/s1 |
| InChIKey | QATISCJMIITVAB-CNEPTXDISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mogroside IIIE (CHEBI:232044) has functional parent mogroside IE (CHEBI:138975) |
| mogroside IIIE (CHEBI:232044) has role antifibrotic agent (CHEBI:233423) |
| mogroside IIIE (CHEBI:232044) has role plant metabolite (CHEBI:76924) |
| mogroside IIIE (CHEBI:232044) is a disaccharide derivative (CHEBI:63353) |
| mogroside IIIE (CHEBI:232044) is a mogroside (CHEBI:139477) |
| mogroside IIIE (CHEBI:232044) is a β-D-glucoside (CHEBI:22798) |
| Synonym | Source |
|---|---|
| MIIIE | SUBMITTER |
| UniProt Name | Source |
|---|---|
| mogroside IIIE | UniProt |
| Citations |
|---|