EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18ClN |
| Net Charge | 0 |
| Average Mass | 247.769 |
| Monoisotopic Mass | 247.11278 |
| SMILES | CC(C)NCC(Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18ClN/c1-11(2)17-10-15(16)14-8-7-12-5-3-4-6-13(12)9-14/h3-9,11,15,17H,10H2,1-2H3 |
| InChIKey | DNEBDVGIWMFUMW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine (CHEBI:232040) is a naphthalenes (CHEBI:25477) |
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine (CHEBI:232040) is a organochlorine compound (CHEBI:36683) |
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine (CHEBI:232040) is a secondary amino compound (CHEBI:50995) |
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine (CHEBI:232040) is conjugate base of N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-aminium (CHEBI:232041) |
| Incoming Relation(s) |
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-aminium (CHEBI:232041) is conjugate acid of N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine (CHEBI:232040) |
| IUPAC Name |
|---|
| N-[2-chloro-2-(naphthalen-2-yl)ethyl]propan-2-amine |
| Synonyms | Source |
|---|---|
| [2-chloro-2-(naphthalen-2-yl)ethyl](propan-2-yl)amine | ChEBI |
| [2-chloro-2-(naphthalen-2-yl)ethyl](isopropyl)amine | ChEBI |
| β-chloro-N-(1-methylethyl)-2-naphthaleneethanamine | ChEBI |
| ICI-42464 (free base) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1085-07-0 | ChEBI |