EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@@]12[C@@H](O)[C@@H](O)[C@@]3([H])C(=C)[C@]1(C)CC[C@H](C(C)C)[C@@]23[H] |
| InChI | InChI=1S/C15H24O2/c1-7(2)9-5-6-15(4)8(3)10-11(9)12(15)14(17)13(10)16/h7,9-14,16-17H,3,5-6H2,1-2,4H3/t9-,10+,11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | WESKDXUXCFNPHE-NRFRHTMUSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-14,15-dihydroxysativene (CHEBI:232034) has role fungal metabolite (CHEBI:76946) |
| (−)-14,15-dihydroxysativene (CHEBI:232034) is a bridged compound (CHEBI:35990) |
| (−)-14,15-dihydroxysativene (CHEBI:232034) is a organic hydroxy compound (CHEBI:33822) |
| (−)-14,15-dihydroxysativene (CHEBI:232034) is a sesquiterpene (CHEBI:35189) |
| UniProt Name | Source |
|---|---|
| (−)-14,15-dihydroxysativene | UniProt |
| Citations |
|---|