EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@]3([H])C(=C)[C@]1(C)CC[C@H](C(C)C)[C@@]23[H] |
| InChI | InChI=1S/C15H24O/c1-8(2)10-5-6-15(4)9(3)13-12(16)7-11(15)14(10)13/h8,10-14,16H,3,5-7H2,1-2,4H3/t10-,11+,12-,13-,14+,15+/m1/s1 |
| InChIKey | RPNKLDOVFUJEJN-QLKXBERHSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-15-hydroxysativene (CHEBI:232033) has role fungal metabolite (CHEBI:76946) |
| (−)-15-hydroxysativene (CHEBI:232033) is a bridged compound (CHEBI:35990) |
| (−)-15-hydroxysativene (CHEBI:232033) is a organic hydroxy compound (CHEBI:33822) |
| (−)-15-hydroxysativene (CHEBI:232033) is a sesquiterpene (CHEBI:35189) |
| UniProt Name | Source |
|---|---|
| (−)-15-hydroxysativene | UniProt |
| Citations |
|---|