EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H65O17 |
| Net Charge | -1 |
| Average Mass | 865.987 |
| Monoisotopic Mass | 865.42272 |
| SMILES | CCCCCCCCCc1cc(OC(=O)c2c(CCCCCCCCC)cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)cc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c1C(=O)[O-] |
| InChI | InChI=1S/C44H66O17/c1-3-5-7-9-11-13-15-17-25-19-27(21-29(47)33(25)41(54)55)57-42(56)34-26(18-16-14-12-10-8-6-4-2)20-28(58-43-39(52)37(50)35(48)31(23-45)60-43)22-30(34)59-44-40(53)38(51)36(49)32(24-46)61-44/h19-22,31-32,35-40,43-53H,3-18,23-24H2,1-2H3,(H,54,55)/p-1/t31-,32-,35+,36-,37+,38+,39-,40-,43-,44-/m1/s1 |
| InChIKey | RFNVSJROQFSJNW-ZIFFENNXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phaeomoniecin D(1−) (CHEBI:232032) is a monohydroxybenzoate (CHEBI:25388) |
| phaeomoniecin D(1−) (CHEBI:232032) is conjugate base of phaeomoniecin D (CHEBI:232066) |
| Incoming Relation(s) |
| phaeomoniecin D (CHEBI:232066) is conjugate acid of phaeomoniecin D(1−) (CHEBI:232032) |
| IUPAC Name |
|---|
| 4-{[4-(β-D-galactopyranosyloxy)-2-(β-D-glucopyranosyloxy)-6-nonylbenzoyl]oxy}-2-hydroxy-6-nonylbenzoate |
| Synonym | Source |
|---|---|
| phaeomoniecin D anion | ChEBI |
| UniProt Name | Source |
|---|---|
| phaeomoniecin D | UniProt |
| Citations |
|---|