EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:231990 - 4-Amino-1-piperidinecarboxylic acid
| Formula | C6H12N2O2 |
| Net Charge | 0 |
| Average Mass | 144.174 |
| Monoisotopic Mass | 144.08988 |
| SMILES | NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C6H12N2O2/c7-5-1-3-8(4-2-5)6(9)10/h5H,1-4,7H2,(H,9,10) |
| InChIKey | NQNQKLBWDARKDG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | esophageal mucosa (BTO:0002859) | MetaboLights (MTBLS4816) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Amino-1-piperidinecarboxylic acid (CHEBI:231990) is a carboxylic acid (CHEBI:33575) |
| 4-Amino-1-piperidinecarboxylic acid (CHEBI:231990) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 4-aminopiperidine-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C16837 | KEGG COMPOUND |
| MRM | PDBeChem |
| HMDB0060385 | HMDB |