EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H26O18 |
| Net Charge | 0 |
| Average Mass | 650.498 |
| Monoisotopic Mass | 650.11191 |
| SMILES | COC1OC(COC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c2cc(O)c(O)c(O)c2)C1O |
| InChI | InChI=1S/C28H26O18/c1-42-28-22(38)24(46-27(41)11-6-16(33)21(37)17(34)7-11)23(45-26(40)10-4-14(31)20(36)15(32)5-10)18(44-28)8-43-25(39)9-2-12(29)19(35)13(30)3-9/h2-7,18,22-24,28-38H,8H2,1H3 |
| InChIKey | DXMITXYQZDSXOV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | esophageal mucosa (BTO:0002859) | MetaboLights (MTBLS4816) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3,4,6-tri-O-galloyl-beta-D-glucopyranoside (CHEBI:231987) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [5-hydroxy-6-methoxy-3,4-bis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039183 | HMDB |