EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5AsNO5 |
| Net Charge | -1 |
| Average Mass | 246.030 |
| Monoisotopic Mass | 245.93892 |
| SMILES | O=[N+]([O-])c1cc([As](O)O)ccc1[O-] |
| InChI | InChI=1S/C6H6AsNO5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9-11H/p-1 |
| InChIKey | YAODANCEJHIXBW-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxarsone (III) (CHEBI:231974) is a 2-nitrophenols (CHEBI:86421) |
| roxarsone (III) (CHEBI:231974) is a arsonous acids (CHEBI:50017) |
| IUPAC Name |
|---|
| 4-dihydroxyarsanyl-2-nitrophenolate |
| Synonyms | Source |
|---|---|
| rox(III) | SUBMITTER |
| 3-nitro-4-hydroxyphenylarsenite | SUBMITTER |
| UniProt Name | Source |
|---|---|
| roxarsone (III) | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22656 | MetaCyc |