EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O2 |
| Net Charge | 0 |
| Average Mass | 118.176 |
| Monoisotopic Mass | 118.09938 |
| SMILES | C[C@H](O)CC[C@H](C)O |
| InChI | InChI=1S/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | OHMBHFSEKCCCBW-WDSKDSINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,5S)-hexanediol (CHEBI:231969) is a hexane-2,5-diol (CHEBI:84894) |
| (2S,5S)-hexanediol (CHEBI:231969) is enantiomer of (2R,5R)-hexanediol (CHEBI:177024) |
| Incoming Relation(s) |
| (2R,5R)-hexanediol (CHEBI:177024) is enantiomer of (2S,5S)-hexanediol (CHEBI:231969) |
| IUPAC Name |
|---|
| (2S,5S)-hexane-2,5-diol |
| Synonyms | Source |
|---|---|
| (2S,5S)-2,5-dihydroxyhexane | ChEBI |
| (2S,5S)-2,5-hexanediol | ChEBI |
| (2S,5S)-(+)-hexanediol | ChEBI |
| (S,S)-2,5-hexanediol | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S,5S)-hexanediol | UniProt |
| Citations |
|---|