EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | [H]C(=O)C1=Cc2ccc(O)c(OC)c2[C@]([H])(c2ccc(OC)c(OC)c2)[C@H]1CO |
| InChI | InChI=1S/C21H22O6/c1-25-17-7-5-13(9-18(17)26-2)19-15(11-23)14(10-22)8-12-4-6-16(24)21(27-3)20(12)19/h4-10,15,19,23-24H,11H2,1-3H3/t15-,19+/m0/s1 |
| InChIKey | PKQMYUZVEPUWBD-HNAYVOBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitex trifolia (ncbitaxon:204215) | fruit (BTO:0000486) | PubMed (38659592) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitekwangin B (CHEBI:231954) has role antineoplastic agent (CHEBI:35610) |
| vitekwangin B (CHEBI:231954) has role plant metabolite (CHEBI:76924) |
| vitekwangin B (CHEBI:231954) is a aldehyde (CHEBI:17478) |
| vitekwangin B (CHEBI:231954) is a dihydronaphthalenes (CHEBI:90740) |
| vitekwangin B (CHEBI:231954) is a dimethoxybenzene (CHEBI:51681) |
| vitekwangin B (CHEBI:231954) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (3R,4S)-4-(3,4-dimethoxyphenyl)-6-hydroxy-3-(hydroxymethyl)-5-methoxy-3,4-dihydronaphthalene-2-carbaldehyde |
| Synonym | Source |
|---|---|
| VWB | ChEBI |
| Citations |
|---|