EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H30FN5O4 |
| Net Charge | 0 |
| Average Mass | 555.610 |
| Monoisotopic Mass | 555.22818 |
| SMILES | N#Cc1ccc(COc2cccc(C3CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@@H]4CCO4)CC3)n2)c(F)c1 |
| InChI | InChI=1S/C31H30FN5O4/c32-25-14-20(16-33)4-5-23(25)19-41-30-3-1-2-26(35-30)21-8-11-36(12-9-21)18-29-34-27-7-6-22(31(38)39)15-28(27)37(29)17-24-10-13-40-24/h1-7,14-15,21,24H,8-13,17-19H2,(H,38,39)/t24-/m0/s1 |
| InChIKey | HYBAKUMPISVZQP-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. glucagon-like peptide-1 receptor agonist An agonist that binds to and activates glucagon-like peptide-1 (GLP-1) receptors. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danuglipron (CHEBI:231951) has role anti-obesity agent (CHEBI:74518) |
| danuglipron (CHEBI:231951) has role glucagon-like peptide-1 receptor agonist (CHEBI:71196) |
| danuglipron (CHEBI:231951) has role hypoglycemic agent (CHEBI:35526) |
| danuglipron (CHEBI:231951) is a aromatic ether (CHEBI:35618) |
| danuglipron (CHEBI:231951) is a benzimidazolecarboxylic acid (CHEBI:35688) |
| danuglipron (CHEBI:231951) is a monofluorobenzenes (CHEBI:83575) |
| danuglipron (CHEBI:231951) is a nitrile (CHEBI:18379) |
| danuglipron (CHEBI:231951) is a oxetanes (CHEBI:38784) |
| danuglipron (CHEBI:231951) is a piperidines (CHEBI:26151) |
| danuglipron (CHEBI:231951) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-[(4-{6-[(4-cyano-2-fluorobenzyl)oxy]pyridin-2-yl}piperidin-1-yl)methyl]-1-[(2S)-oxetan-2-ylmethyl]-1H-benzimidazole-6-carboxylic acid |
| INNs | Source |
|---|---|
| danugliprón | WHO MedNet |
| danuglipronum | WHO MedNet |
| danuglipron | WHO MedNet |
| danuglipron | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-06882961 | ChEBI |
| PF 06882961 | ChEBI |
| PF06882961 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D11910 | KEGG DRUG |
| Danuglipron | Wikipedia |
| UK4 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:2230198-02-2 | KEGG DRUG |
| Citations |
|---|