EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12ClN3O5 |
| Net Charge | 0 |
| Average Mass | 373.752 |
| Monoisotopic Mass | 373.04655 |
| SMILES | O=C(O)CNC(=O)c1ncc(-c2cc(-c3cccc(Cl)c3)no2)cc1O |
| InChI | InChI=1S/C17H12ClN3O5/c18-11-3-1-2-9(4-11)12-6-14(26-21-12)10-5-13(22)16(19-7-10)17(25)20-8-15(23)24/h1-7,22H,8H2,(H,20,25)(H,23,24) |
| InChIKey | LXJZOEXMNSUCFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ZG-2291 (CHEBI:231945) has role anti-obesity agent (CHEBI:74518) |
| ZG-2291 (CHEBI:231945) is a isoxazoles (CHEBI:55373) |
| ZG-2291 (CHEBI:231945) is a monocarboxylic acid (CHEBI:25384) |
| ZG-2291 (CHEBI:231945) is a monochlorobenzenes (CHEBI:83403) |
| ZG-2291 (CHEBI:231945) is a monohydroxypyridine (CHEBI:38182) |
| ZG-2291 (CHEBI:231945) is a pyridinecarboxamide (CHEBI:25529) |
| ZG-2291 (CHEBI:231945) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-({5-[3-(3-chlorophenyl)-1,2-oxazol-5-yl]-3-hydroxypyridin-2-yl}carbonyl)glycine |
| Synonyms | Source |
|---|---|
| ZG 2291 | ChEBI |
| ZG2291 | ChEBI |
| 2-[[5-[3-(3-chlorophenyl)-1,2-oxazol-5-yl]-3-oxidanyl-pyridin-2-yl]carbonylamino]ethanoic acid | PDBeChem |
| [({5-[3-(3-chlorophenyl)-1,2-oxazol-5-yl]-3-hydroxypyridin-2-yl}carbonyl)amino]acetic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| P5I | PDBeChem |
| Citations |
|---|