EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O4 |
| Net Charge | 0 |
| Average Mass | 298.338 |
| Monoisotopic Mass | 298.12051 |
| SMILES | CO/C=C(\Oc1cc(-c2ccccc2)ccc1C)C(=O)OC |
| InChI | InChI=1S/C18H18O4/c1-13-9-10-15(14-7-5-4-6-8-14)11-16(13)22-17(12-20-2)18(19)21-3/h4-12H,1-3H3/b17-12- |
| InChIKey | IWSICNFCWDNIOY-ATVHPVEESA-N |
| Roles Classification |
|---|
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bifemetstrobin (CHEBI:231944) has role fungicide (CHEBI:24127) |
| bifemetstrobin (CHEBI:231944) is a aromatic ether (CHEBI:35618) |
| bifemetstrobin (CHEBI:231944) is a biphenyls (CHEBI:22888) |
| bifemetstrobin (CHEBI:231944) is a enoate ester (CHEBI:51702) |
| bifemetstrobin (CHEBI:231944) is a enol ether (CHEBI:47985) |
| bifemetstrobin (CHEBI:231944) is a methyl ester (CHEBI:25248) |
| bifemetstrobin (CHEBI:231944) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| methyl (2Z)-3-methoxy-2-[(4-methyl[biphenyl]-3-yl)oxy]prop-2-enoate |
| Synonyms | Source |
|---|---|
| bifémétstrobine | ChEBI |
| methyl (2Z)-3-methoxy-2-[(4-methyl[1,1'-biphenyl]-3-yl)oxy]-2-propenoate | ChEBI |
| methyl (2Z)-3-methoxy-2-[(4-methyl[1,1'-biphenyl]-3-yl)oxy]prop-2-enoate | IUPAC |
| methyl (2Z)-3-methoxy-2-[(4-methylbiphenyl-3-yl)oxy]acrylate | ChEBI |
| methyl (2Z)-3-methoxy-2-[(4-methylbiphenyl-3-yl)oxy]prop-2-enoate | Alan Wood's Pesticides |
| S 2326 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bifemetstrobin | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:38272783 | Reaxys |
| CAS:2454319-63-0 | Alan Wood's Pesticides |