EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NOS |
| Net Charge | 0 |
| Average Mass | 91.135 |
| Monoisotopic Mass | 91.00918 |
| SMILES | CN(O)C=S |
| InChI | InChI=1S/C2H5NOS/c1-3(4)2-5/h2,4H,1H3 |
| InChIKey | LSLVHNSGLHQBDX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluopsin (CHEBI:231919) has functional parent N-hydroxymethanethioamide (CHEBI:231920) |
| fluopsin (CHEBI:231919) has role antibacterial agent (CHEBI:33282) |
| fluopsin (CHEBI:231919) is a hydroxylamines (CHEBI:24709) |
| fluopsin (CHEBI:231919) is a thiocarbonyl compound (CHEBI:50492) |
| IUPAC Name |
|---|
| N-hydroxy-N-methylthioformamide |
| Synonyms | Source |
|---|---|
| N-methyl-N-hydroxythioxomethylamine | ChEBI |
| N-methyl-N-(thioformyl)hydroxylamine | ChEBI |
| N-methyl-N-thioformylhydroxylamine | ChEBI |
| thioformin | ChEBI |
| UniProt Name | Source |
|---|---|
| fluopsin | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:31335-60-1 | ChEBI |
| Citations |
|---|