EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClFNO3 |
| Net Charge | 0 |
| Average Mass | 333.746 |
| Monoisotopic Mass | 333.05680 |
| SMILES | C#CCOc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H13ClFNO3/c1-2-7-23-15-9-14(13(19)8-12(15)18)20-16(21)10-5-3-4-6-11(10)17(20)22/h1,8-9H,3-7H2 |
| InChIKey | QAWLSTWQUFLACC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-23142 (CHEBI:231817) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| S-23142 (CHEBI:231817) has role herbicide (CHEBI:24527) |
| S-23142 (CHEBI:231817) is a aromatic ether (CHEBI:35618) |
| S-23142 (CHEBI:231817) is a maleimides (CHEBI:55417) |
| S-23142 (CHEBI:231817) is a monochlorobenzenes (CHEBI:83403) |
| S-23142 (CHEBI:231817) is a monofluorobenzenes (CHEBI:83575) |
| S-23142 (CHEBI:231817) is a phthalimides (CHEBI:82851) |
| S-23142 (CHEBI:231817) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 2-[4-chloro-2-fluoro-5-(prop-2-yn-1-yloxy)phenyl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| S 23142 | ChEBI |
| S23142 | ChEBI |
| N-[4-chloro-2-fluoro-5-propargyloxy]phenyl-3,4,5,6-tetrahydrophthalimide | ChEBI |
| N-(4-chloro-2-fluoro-5-propargyloxyphenyl)-3,4,5,6-tetrahydrophthalimide | ChEBI |
| Citations |
|---|