EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12F4N6O |
| Net Charge | 0 |
| Average Mass | 416.338 |
| Monoisotopic Mass | 416.10087 |
| SMILES | N#Cc1ncn(CC(=O)N2Cc3ccc(-c4cc(F)cnc4C(F)(F)F)cc3C2)n1 |
| InChI | InChI=1S/C19H12F4N6O/c20-14-4-15(18(25-6-14)19(21,22)23)11-1-2-12-7-28(8-13(12)3-11)17(30)9-29-10-26-16(5-24)27-29/h1-4,6,10H,7-9H2 |
| InChIKey | JDTWUDDOSHJEIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CT3 (CHEBI:231816) has role topoisomerase II inhibitor (CHEBI:156203) |
| CT3 (CHEBI:231816) has role trypanocidal drug (CHEBI:36335) |
| CT3 (CHEBI:231816) is a isoindoles (CHEBI:24897) |
| CT3 (CHEBI:231816) is a ketone (CHEBI:17087) |
| CT3 (CHEBI:231816) is a nitrile (CHEBI:18379) |
| CT3 (CHEBI:231816) is a organofluorine compound (CHEBI:37143) |
| CT3 (CHEBI:231816) is a pyridines (CHEBI:26421) |
| CT3 (CHEBI:231816) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 1-(2-{5-[5-fluoro-2-(trifluoromethyl)pyridin-3-yl]-1,3-dihydro-2H-isoindol-2-yl}-2-oxoethyl)-1H-1,2,4-triazole-3-carbonitrile |
| Synonyms | Source |
|---|---|
| 1-[2-[5-[5-fluoro-2-(trifluoromethyl)-3-pyridinyl]-1,3-dihydro-2H-isoindol-2-yl]-2-oxoethyl]-1H-1,2,4-triazole-3-carbonitrile | ChEBI |
| 1-(2-{5-[5-fluoro-2-(trifluoromethyl)pyridin-3-yl]isoindolin-2-yl}-2-oxoethyl)-1H-1,2,4-triazole-3-carbonitrile | ChEBI |
| compound CT3 | ChEBI |
| CT 3 | ChEBI |
| CT-3 | ChEBI |
| cyanotriazole 3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 128942099 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:35502681 | Reaxys |
| CAS:2403729-27-9 | ChEBI |
| Citations |
|---|