EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H40NO7 |
| Net Charge | -1 |
| Average Mass | 430.562 |
| Monoisotopic Mass | 430.28103 |
| SMILES | CCCCCC[C@@H](O)CCCCCC/C=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](NC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(26)20(27)21(28)19(22(29)30)23-16(2)24/h12,15,17-21,25-28H,3-11,13-14H2,1-2H3,(H,23,24)(H,29,30)/p-1/b15-12+/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | VKFZVQCKAPPEFZ-RXCFHPIVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphingofungin D zwitterion (CHEBI:231811) is a long-chain fatty acid anion (CHEBI:57560) |
| sphingofungin D zwitterion (CHEBI:231811) is tautomer of Sphingofungin D (CHEBI:187239) |
| Incoming Relation(s) |
| Sphingofungin D (CHEBI:187239) is tautomer of sphingofungin D zwitterion (CHEBI:231811) |
| UniProt Name | Source |
|---|---|
| sphingofungin D | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26569 | MetaCyc |
| Citations |
|---|