EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO7 |
| Net Charge | 0 |
| Average Mass | 431.570 |
| Monoisotopic Mass | 431.28830 |
| SMILES | CCCCCC[C@@H](O)CCCCCC/C=C/[C@H](OC(C)=O)[C@@H](O)[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(30-16(2)24)20(26)21(27)19(23)22(28)29/h12,15,17-21,25-27H,3-11,13-14,23H2,1-2H3,(H,28,29)/b15-12+/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | PBKBHDLANIOIKK-RXCFHPIVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphingofungin C zwitterion (CHEBI:231808) is a long-chain fatty acid anion (CHEBI:57560) |
| sphingofungin C zwitterion (CHEBI:231808) is a α-amino-acid zwitterion (CHEBI:78608) |
| sphingofungin C zwitterion (CHEBI:231808) is tautomer of Sphingofungin C (CHEBI:216158) |
| Incoming Relation(s) |
| Sphingofungin C (CHEBI:216158) is tautomer of sphingofungin C zwitterion (CHEBI:231808) |
| UniProt Name | Source |
|---|---|
| sphingofungin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26568 | MetaCyc |
| Citations |
|---|