EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CC[C@]3([H])C(=C)[C@@]1(C)CC[C@@H](C(C)C)[C@]23[H] |
| InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | VOBBUADSYROGAT-VYDRJRHOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-sativene (CHEBI:231783) has role plant metabolite (CHEBI:76924) |
| (+)-sativene (CHEBI:231783) is a bridged compound (CHEBI:35990) |
| (+)-sativene (CHEBI:231783) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,3aR,4S,7S,7aS)-4-methyl-8-methylidene-7-(propan-2-yl)octahydro-1H-1,4-methanoindene |
| UniProt Name | Source |
|---|---|
| (+)-sativene | UniProt |
| Citations |
|---|