EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)C1Cc2cc(O)c(O)cc2N1 |
| InChI | InChI=1S/C9H9NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h2-3,6,10-12H,1H2,(H,13,14) |
| InChIKey | JDWYRSDDJVCWPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dihydroxyindoline-2-carboxylic acid (CHEBI:231764) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 5,6-dihydroxyindoline-2-carboxylic acid (CHEBI:231764) is a indoles (CHEBI:24828) |
| 5,6-dihydroxyindoline-2-carboxylic acid (CHEBI:231764) is conjugate acid of 5,6-dihydroxyindoline-2-carboxylate (CHEBI:231765) |
| Incoming Relation(s) |
| leucodopachrome (CHEBI:60872) is a 5,6-dihydroxyindoline-2-carboxylic acid (CHEBI:231764) |
| 5,6-dihydroxyindoline-2-carboxylate (CHEBI:231765) is conjugate base of 5,6-dihydroxyindoline-2-carboxylic acid (CHEBI:231764) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2,3-dihydro-1H-indole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-carboxy-5,6-dihydroxy-2,3-dihydro-1H-indole | ChEBI |
| 2-carboxy-5,6-dihydroxyindoline | ChEBI |
| cyclo-DOPA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:18791-20-3 | ChEBI |
| Citations |
|---|