EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12S2 |
| Net Charge | 0 |
| Average Mass | 148.296 |
| Monoisotopic Mass | 148.03804 |
| SMILES | CSSCC=C(C)C |
| InChI | InChI=1S/C6H12S2/c1-6(2)4-5-8-7-3/h4H,5H2,1-3H3 |
| InChIKey | IUWTWUFCWBZDLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-1-(methyldisulfanyl)but-2-ene (CHEBI:231758) has functional parent 3-Methyl-2-butene-1-thiol (CHEBI:169260) |
| 3-methyl-1-(methyldisulfanyl)but-2-ene (CHEBI:231758) has role flavouring agent (CHEBI:35617) |
| 3-methyl-1-(methyldisulfanyl)but-2-ene (CHEBI:231758) is a olefinic compound (CHEBI:78840) |
| 3-methyl-1-(methyldisulfanyl)but-2-ene (CHEBI:231758) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| 3-methyl-1-(methyldisulfanyl)but-2-ene |
| Synonyms | Source |
|---|---|
| FEMA 4993 | ChEBI |
| methyl 2-(3-buten-2-enyl)disulfide | ChEBI |
| 1-methyl-2-(3-methylbut-2-en-1-yl)disulfane | ChEBI |
| methyl 3-methyl-2-buten-1-yl disulfide | ChEBI |
| methyl isopentenyl disulfide | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2424984 | Reaxys |
| CAS:34776-60-8 | ChEBI |