EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N2O3 |
| Net Charge | +1 |
| Average Mass | 365.453 |
| Monoisotopic Mass | 365.18597 |
| SMILES | COc1ccc2c(c1)[C@@]13CC[NH+]4CC5=CCO[C@H]6CC(=O)N2[C@H]1[C@H]6[C@H]5C[C@H]43 |
| InChI | InChI=1S/C22H24N2O3/c1-26-13-2-3-16-15(8-13)22-5-6-23-11-12-4-7-27-17-10-19(25)24(16)21(22)20(17)14(12)9-18(22)23/h2-4,8,14,17-18,20-21H,5-7,9-11H2,1H3/p+1/t14-,17-,18-,20-,21-,22+/m0/s1 |
| InChIKey | ZTHVHELPCLGXHF-JPPAUQSISA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-colubrine(1+) (CHEBI:231755) is a indole alkaloid cation (CHEBI:60521) |
| β-colubrine(1+) (CHEBI:231755) is conjugate acid of β-colubrine (CHEBI:132697) |
| Incoming Relation(s) |
| β-colubrine (CHEBI:132697) is conjugate base of β-colubrine(1+) (CHEBI:231755) |
| UniProt Name | Source |
|---|---|
| β-colubrine | UniProt |
| Citations |
|---|