EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N2O2 |
| Net Charge | +1 |
| Average Mass | 335.427 |
| Monoisotopic Mass | 335.17540 |
| SMILES | O=C1CC=C2[C@H]3C[C@@H]4[NH+](CC[C@@]45c4ccccc4N1[C@@H]25)C/C3=C/CO |
| InChI | InChI=1S/C21H22N2O2/c24-10-7-13-12-22-9-8-21-16-3-1-2-4-17(16)23-19(25)6-5-14(20(21)23)15(13)11-18(21)22/h1-5,7,15,18,20,24H,6,8-12H2/p+1/b13-7-/t15-,18-,20-,21+/m0/s1 |
| InChIKey | PNYOGGAOQVIZDM-JQNVFVSUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isostrychnine(1+) (CHEBI:231753) is a indole alkaloid cation (CHEBI:60521) |
| isostrychnine(1+) (CHEBI:231753) is conjugate acid of isostrychnine (CHEBI:132659) |
| Incoming Relation(s) |
| isostrychnine (CHEBI:132659) is conjugate base of isostrychnine(1+) (CHEBI:231753) |
| UniProt Name | Source |
|---|---|
| isostrychnine | UniProt |
| Citations |
|---|