EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O5Sb |
| Net Charge | 0 |
| Average Mass | 318.926 |
| Monoisotopic Mass | 317.94881 |
| SMILES | O=C(O)/C=C/c1ccc[c]([Sb](=[O])([OH])[OH])c1 |
| InChI | InChI=1S/C9H7O2.2H2O.O.Sb/c10-9(11)7-6-8-4-2-1-3-5-8;;;;/h1-2,4-7H,(H,10,11);2*1H2;;/q;;;;+2/p-2/b7-6+;;;; |
| InChIKey | ZTQRMGDLUGQTTF-MNPOOLNOSA-L |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stibavirin (CHEBI:231728) has role anti-HIV-1 agent (CHEBI:64947) |
| stibavirin (CHEBI:231728) is a antimony oxoacid (CHEBI:36920) |
| stibavirin (CHEBI:231728) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (2E)-3-{3-[dihydroxy(oxido)-λ5-stibanyl]phenyl}prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| NSC13778 | ChEBI |
| NSC 13778 | ChEBI |
| NSC-13778 | ChEBI |
| (E)-3-(3-stibonophenyl)acrylic acid | ChEBI |
| 3-(3-(dihydroxyoxidostibino)phenyl)-2-propenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:501444-04-8 | ChEBI |
| Citations |
|---|