EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N3O2 |
| Net Charge | 0 |
| Average Mass | 449.639 |
| Monoisotopic Mass | 449.30423 |
| SMILES | [H][C@@](c1ccc(C(=O)N(CC)CC)cc1)(c1cccc(OC)c1)N1C[C@@H](C)N(CC=C)C[C@@H]1C |
| InChI | InChI=1S/C28H39N3O2/c1-7-17-30-19-22(5)31(20-21(30)4)27(25-11-10-12-26(18-25)33-6)23-13-15-24(16-14-23)28(32)29(8-2)9-3/h7,10-16,18,21-22,27H,1,8-9,17,19-20H2,2-6H3/t21-,22+,27-/m1/s1 |
| InChIKey | KQWVAUSXZDRQPZ-UMTXDNHDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. convulsant A drug that induces seizures or increases their severity. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SNC-80 (CHEBI:231727) has role antidepressant (CHEBI:35469) |
| SNC-80 (CHEBI:231727) has role antineoplastic agent (CHEBI:35610) |
| SNC-80 (CHEBI:231727) has role anxiolytic drug (CHEBI:35474) |
| SNC-80 (CHEBI:231727) has role convulsant (CHEBI:231761) |
| SNC-80 (CHEBI:231727) has role opioid analgesic (CHEBI:35482) |
| SNC-80 (CHEBI:231727) has role δ-opioid receptor agonist (CHEBI:64054) |
| SNC-80 (CHEBI:231727) is a N-alkylpiperazine (CHEBI:46845) |
| SNC-80 (CHEBI:231727) is a benzamides (CHEBI:22702) |
| SNC-80 (CHEBI:231727) is a monomethoxybenzene (CHEBI:25235) |
| SNC-80 (CHEBI:231727) is a olefinic compound (CHEBI:78840) |
| SNC-80 (CHEBI:231727) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 4-[(R)-[(2S,5R)-2,5-dimethyl-4-(prop-2-en-1-yl)piperazin-1-yl](3-methoxyphenyl)methyl]-N,N-diethylbenzamide |
| Synonyms | Source |
|---|---|
| 4-[(R)-[(2S,5R)-2,5-dimethyl-4-(2-propen-1-yl)-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethylbenzamide | ChEBI |
| (+)-4-[(αR)-α-((2S,5R)-4-allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl]-N,N-diethylbenzamide | ChEBI |
| SNC 80 | ChEBI |
| SNC80 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SNC-80 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:156727-74-1 | ChEBI |
| Citations |
|---|