EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N3O2 |
| Net Charge | 0 |
| Average Mass | 449.639 |
| Monoisotopic Mass | 449.30423 |
| SMILES | [H][C@@](c1ccc(C(=O)N(CC)CC)cc1)(c1cccc(OC)c1)N1C[C@@H](C)N(CC=C)C[C@@H]1C |
| InChI | InChI=1S/C28H39N3O2/c1-7-17-30-19-22(5)31(20-21(30)4)27(25-11-10-12-26(18-25)33-6)23-13-15-24(16-14-23)28(32)29(8-2)9-3/h7,10-16,18,21-22,27H,1,8-9,17,19-20H2,2-6H3/t21-,22+,27-/m1/s1 |
| InChIKey | KQWVAUSXZDRQPZ-UMTXDNHDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. convulsant A drug that induces seizures or increases their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SNC-80 (CHEBI:231727) has role antidepressant (CHEBI:35469) |
| SNC-80 (CHEBI:231727) has role antineoplastic agent (CHEBI:35610) |
| SNC-80 (CHEBI:231727) has role anxiolytic drug (CHEBI:35474) |
| SNC-80 (CHEBI:231727) has role convulsant (CHEBI:231761) |
| SNC-80 (CHEBI:231727) has role opioid analgesic (CHEBI:35482) |
| SNC-80 (CHEBI:231727) has role δ-opioid receptor agonist (CHEBI:64054) |
| SNC-80 (CHEBI:231727) is a N-alkylpiperazine (CHEBI:46845) |
| SNC-80 (CHEBI:231727) is a benzamides (CHEBI:22702) |
| SNC-80 (CHEBI:231727) is a monomethoxybenzene (CHEBI:25235) |
| SNC-80 (CHEBI:231727) is a olefinic compound (CHEBI:78840) |
| SNC-80 (CHEBI:231727) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 4-[(R)-[(2S,5R)-2,5-dimethyl-4-(prop-2-en-1-yl)piperazin-1-yl](3-methoxyphenyl)methyl]-N,N-diethylbenzamide |
| Synonyms | Source |
|---|---|
| 4-[(R)-[(2S,5R)-2,5-dimethyl-4-(2-propen-1-yl)-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethylbenzamide | ChEBI |
| (+)-4-[(αR)-α-((2S,5R)-4-allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl]-N,N-diethylbenzamide | ChEBI |
| SNC 80 | ChEBI |
| SNC80 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SNC-80 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:156727-74-1 | ChEBI |
| Citations |
|---|