EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33ClN2O3 |
| Net Charge | 0 |
| Average Mass | 517.069 |
| Monoisotopic Mass | 516.21797 |
| SMILES | Cc1ccc(C(=O)N(CCCN)[C@@H](c2oc3cc(Cl)ccc3c(=O)c2Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C31H33ClN2O3/c1-20(2)28(34(17-7-16-33)31(36)23-12-10-21(3)11-13-23)30-26(18-22-8-5-4-6-9-22)29(35)25-15-14-24(32)19-27(25)37-30/h4-6,8-15,19-20,28H,7,16-18,33H2,1-3H3/t28-/m1/s1 |
| InChIKey | PGXYIBJJCLWJST-MUUNZHRXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB-743921 (CHEBI:231716) has role antineoplastic agent (CHEBI:35610) |
| SB-743921 (CHEBI:231716) has role apoptosis inducer (CHEBI:68495) |
| SB-743921 (CHEBI:231716) has role microtubule-destabilising agent (CHEBI:61951) |
| SB-743921 (CHEBI:231716) is a benzamides (CHEBI:22702) |
| SB-743921 (CHEBI:231716) is a benzenes (CHEBI:22712) |
| SB-743921 (CHEBI:231716) is a chromones (CHEBI:23238) |
| SB-743921 (CHEBI:231716) is a organochlorine compound (CHEBI:36683) |
| SB-743921 (CHEBI:231716) is a primary amino compound (CHEBI:50994) |
| SB-743921 (CHEBI:231716) is a tertiary carboxamide (CHEBI:140326) |
| SB-743921 (CHEBI:231716) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| N-(3-aminopropyl)-N-[(1R)-1-(3-benzyl-7-chloro-4-oxo-4H-chromen-2-yl)-2-methylpropyl]-4-methylbenzamide |
| Synonyms | Source |
|---|---|
| N-(3-aminopropyl)-N-[(1R)-1-(3-benzyl-7-chloro-4-oxochromen-2-yl)-2-methylpropyl]-4-methylbenzamide | SUBMITTER |
| GSK 743921 | ChEBI |
| GSK-743921 | ChEBI |
| GSK743921 | ChEBI |
| GSK-921 | ChEBI |
| SB 743921 | SUBMITTER |
| Citations |
|---|