EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | OC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2/t8-/m0/s1 |
| InChIKey | PWMWNFMRSKOCEY-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-styrene glycol (CHEBI:231713) is a ethanediol derivative (CHEBI:140594) |
| (R)-styrene glycol (CHEBI:231713) is a styrenes (CHEBI:26799) |
| (R)-styrene glycol (CHEBI:231713) is enantiomer of (S)-styrene glycol (CHEBI:231714) |
| Incoming Relation(s) |
| (S)-styrene glycol (CHEBI:231714) is enantiomer of (R)-styrene glycol (CHEBI:231713) |
| IUPAC Name |
|---|
| (1R)-1-phenylethane-1,2-diol |
| Synonym | Source |
|---|---|
| (−)-styrene glycol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (R)-styrene glycol | UniProt |
| Citations |
|---|