EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H17FN6O |
| Net Charge | 0 |
| Average Mass | 412.428 |
| Monoisotopic Mass | 412.14479 |
| SMILES | CNC(=O)c1ccc(-c2cnc3ncc(Cc4ccc5ncccc5c4)n3n2)cc1F |
| InChI | InChI=1S/C23H17FN6O/c1-25-22(31)18-6-5-16(11-19(18)24)21-13-28-23-27-12-17(30(23)29-21)10-14-4-7-20-15(9-14)3-2-8-26-20/h2-9,11-13H,10H2,1H3,(H,25,31) |
| InChIKey | LIOLIMKSCNQPLV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capmatinib (CHEBI:231693) has role antineoplastic agent (CHEBI:35610) |
| capmatinib (CHEBI:231693) has role apoptosis inducer (CHEBI:68495) |
| capmatinib (CHEBI:231693) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| capmatinib (CHEBI:231693) has role hepatotoxic agent (CHEBI:50908) |
| capmatinib (CHEBI:231693) is a benzamides (CHEBI:22702) |
| capmatinib (CHEBI:231693) is a imidazotriazine (CHEBI:46906) |
| capmatinib (CHEBI:231693) is a monofluorobenzenes (CHEBI:83575) |
| capmatinib (CHEBI:231693) is a quinolines (CHEBI:26513) |
| capmatinib (CHEBI:231693) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-fluoro-N-methyl-4-[7-(quinolin-6-ylmethyl)imidazo[1,2-b][1,2,4]triazin-2-yl]benzamide |
| Synonyms | Source |
|---|---|
| INC 280 | ChEBI |
| INC-280 | DrugBank |
| INC280 | DrugBank |
| INCB 28060 | DrugBank |
| INCB-28060 | DrugBank |
| INCB28060 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Capmatinib | Wikipedia |
| D10696 | KEGG DRUG |
| DB11791 | DrugBank |
| HMDB0249595 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1197376-85-4 | SUBMITTER |
| Citations |
|---|