EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O5S |
| Net Charge | 0 |
| Average Mass | 404.488 |
| Monoisotopic Mass | 404.14059 |
| SMILES | CC(C)(O)c1coc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1 |
| InChI | InChI=1S/C20H24N2O5S/c1-20(2,24)14-10-17(27-11-14)28(25,26)22-19(23)21-18-15-7-3-5-12(15)9-13-6-4-8-16(13)18/h9-11,24H,3-8H2,1-2H3,(H2,21,22,23) |
| InChIKey | HUUSXLKCTQDPGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | NLRP3 inhibitor Any inhibitor of NLRP3. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. renoprotective agent Any compound that is able to prevent damage to the kidneys. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MCC950 (CHEBI:231684) has role anti-inflammatory agent (CHEBI:67079) |
| MCC950 (CHEBI:231684) has role neuroprotective agent (CHEBI:63726) |
| MCC950 (CHEBI:231684) has role NLRP3 inhibitor (CHEBI:231916) |
| MCC950 (CHEBI:231684) has role renoprotective agent (CHEBI:231911) |
| MCC950 (CHEBI:231684) is a N-sulfonylurea (CHEBI:76983) |
| MCC950 (CHEBI:231684) is a s-indacenes (CHEBI:51125) |
| MCC950 (CHEBI:231684) is a furans (CHEBI:24129) |
| MCC950 (CHEBI:231684) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)-4-(2-hydroxypropan-2-yl)furan-2-sulfonamide |
| Synonyms | Source |
|---|---|
| CP-456,773 | ChEBI |
| CP-456773 | SUBMITTER |
| CRID3 | SUBMITTER |
| cytokine release inhibitory drug 3 | ChEBI |
| MCC 950 | ChEBI |
| MCC-950 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:210826-40-7 | SUBMITTER |
| Citations |
|---|