EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18F2N4O2S |
| Net Charge | 0 |
| Average Mass | 404.442 |
| Monoisotopic Mass | 404.11185 |
| SMILES | COc1cc(F)ccc1-c1cc(Nc2cc(CS(C)(=N)=O)ccn2)ncc1F |
| InChI | InChI=1S/C19H18F2N4O2S/c1-27-17-8-13(20)3-4-14(17)15-9-19(24-10-16(15)21)25-18-7-12(5-6-23-18)11-28(2,22)26/h3-10,22H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | YZCUMZWULWOUMD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enitociclib (CHEBI:231682) has role antineoplastic agent (CHEBI:35610) |
| enitociclib (CHEBI:231682) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| enitociclib (CHEBI:231682) is a aminopyridine (CHEBI:38207) |
| enitociclib (CHEBI:231682) is a biaryl (CHEBI:64459) |
| enitociclib (CHEBI:231682) is a monofluorobenzenes (CHEBI:83575) |
| enitociclib (CHEBI:231682) is a monomethoxybenzene (CHEBI:25235) |
| enitociclib (CHEBI:231682) is a sulfoximide (CHEBI:38084) |
| IUPAC Name |
|---|
| 5-fluoro-4-(4-fluoro-2-methoxyphenyl)-N-{4-[(S-methylsulfonimidoyl)methyl]pyridin-2-yl}pyridin-2-amine |
| INNs | Source |
|---|---|
| enitociclibum | WHO MedNet |
| enitociclib | WHO MedNet |
| énitociclib | WHO MedNet |
| enitociclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-fluoro-4-(4-fluoro-2-methoxyphenyl)-N-[4-[(methylsulfonimidoyl)methyl]pyridin-2-yl]pyridin-2-amine | SUBMITTER |
| BAY1251152 | ChEBI |
| BAY 1251152 | ChEBI |
| BAY-1251152 | DrugBank |
| VIP152 | DrugBank |
| VIP 152 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB17297 | DrugBank |
| D12525 | KEGG DRUG |
| Enitociclib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1610408-97-3 | ChEBI |
| Citations |
|---|