EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO5S |
| Net Charge | 0 |
| Average Mass | 371.414 |
| Monoisotopic Mass | 371.08274 |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3ccc4c(c3)OCCO4)csc12 |
| InChI | InChI=1S/C19H17NO5S/c21-14-10-17(20-3-5-22-6-4-20)25-18-13(11-26-19(14)18)12-1-2-15-16(9-12)24-8-7-23-15/h1-2,9-11H,3-8H2 |
| InChIKey | BYTKNUOMWLJVNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SF2523 (CHEBI:231676) has role anticoronaviral agent (CHEBI:149553) |
| SF2523 (CHEBI:231676) has role antineoplastic agent (CHEBI:35610) |
| SF2523 (CHEBI:231676) has role apoptosis inducer (CHEBI:68495) |
| SF2523 (CHEBI:231676) has role autophagy inducer (CHEBI:138880) |
| SF2523 (CHEBI:231676) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| SF2523 (CHEBI:231676) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| SF2523 (CHEBI:231676) is a benzodioxine (CHEBI:64096) |
| SF2523 (CHEBI:231676) is a morpholines (CHEBI:38785) |
| SF2523 (CHEBI:231676) is a thienopyran (CHEBI:48910) |
| IUPAC Name |
|---|
| 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholin-4-yl)-7H-thieno[3,2-b]pyran-7-one |
| Synonyms | Source |
|---|---|
| 3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-5-morpholino-7H-thieno[3,2-b]pyran-7-one | SUBMITTER |
| 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-morpholinyl)-7H-thieno[3,2-b]pyran-7-one | ChEBI |
| SF 2523 | ChEBI |
| SF-2523 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 82V | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1174428-47-7 | ChEBI |
| Citations |
|---|