EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO5S |
| Net Charge | 0 |
| Average Mass | 371.414 |
| Monoisotopic Mass | 371.08274 |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3ccc4c(c3)OCCO4)csc12 |
| InChI | InChI=1S/C19H17NO5S/c21-14-10-17(20-3-5-22-6-4-20)25-18-13(11-26-19(14)18)12-1-2-15-16(9-12)24-8-7-23-15/h1-2,9-11H,3-8H2 |
| InChIKey | BYTKNUOMWLJVNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SF2523 (CHEBI:231676) has role anticoronaviral agent (CHEBI:149553) |
| SF2523 (CHEBI:231676) has role antineoplastic agent (CHEBI:35610) |
| SF2523 (CHEBI:231676) has role apoptosis inducer (CHEBI:68495) |
| SF2523 (CHEBI:231676) has role autophagy inducer (CHEBI:138880) |
| SF2523 (CHEBI:231676) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| SF2523 (CHEBI:231676) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| SF2523 (CHEBI:231676) is a benzodioxine (CHEBI:64096) |
| SF2523 (CHEBI:231676) is a morpholines (CHEBI:38785) |
| SF2523 (CHEBI:231676) is a thienopyran (CHEBI:48910) |
| IUPAC Name |
|---|
| 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(morpholin-4-yl)-7H-thieno[3,2-b]pyran-7-one |
| Synonyms | Source |
|---|---|
| 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-morpholinyl)-7H-thieno[3,2-b]pyran-7-one | ChEBI |
| 3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-5-morpholino-7H-thieno[3,2-b]pyran-7-one | SUBMITTER |
| SF 2523 | ChEBI |
| SF-2523 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 82V | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1174428-47-7 | ChEBI |
| Citations |
|---|