EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33N7O3 |
| Net Charge | 0 |
| Average Mass | 479.585 |
| Monoisotopic Mass | 479.26449 |
| SMILES | COc1nnc2ccc(N3CCC(c4ccc(OCCN5CCN(C)C(=O)[C@H]5C)cc4)CC3)nn12 |
| InChI | InChI=1S/C25H33N7O3/c1-18-24(33)29(2)14-15-30(18)16-17-35-21-6-4-19(5-7-21)20-10-12-31(13-11-20)23-9-8-22-26-27-25(34-3)32(22)28-23/h4-9,18,20H,10-17H2,1-3H3/t18-/m1/s1 |
| InChIKey | RSMYFSPOTCDHHJ-GOSISDBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD5153 (CHEBI:231674) has role antineoplastic agent (CHEBI:35610) |
| AZD5153 (CHEBI:231674) has role apoptosis inducer (CHEBI:68495) |
| AZD5153 (CHEBI:231674) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| AZD5153 (CHEBI:231674) is a N-methylpiperazine (CHEBI:46920) |
| AZD5153 (CHEBI:231674) is a aromatic ether (CHEBI:35618) |
| AZD5153 (CHEBI:231674) is a piperazinone (CHEBI:46846) |
| AZD5153 (CHEBI:231674) is a piperidines (CHEBI:26151) |
| AZD5153 (CHEBI:231674) is a triazolopyridazine (CHEBI:48384) |
| IUPAC Name |
|---|
| (3R)-4-(2-{4-[1-(3-methoxy[1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidin-4-yl]phenoxy}ethyl)-1,3-dimethylpiperazin-2-one |
| Synonyms | Source |
|---|---|
| (3R)-4-[2-[4-[1-(3-methoxy-1,2,4-triazolo[4,3-b]pyridazin-6-yl)-4-piperidinyl]phenoxy]ethyl]-1,3-dimethyl-2-piperazinone | SUBMITTER |
| AZD 5153 | ChEBI |
| AZD-5153 | ChEBI |
| Citations |
|---|