EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O5 |
| Net Charge | 0 |
| Average Mass | 368.429 |
| Monoisotopic Mass | 368.16237 |
| SMILES | COc1ccc(CC(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)cc1OC |
| InChI | InChI=1S/C22H24O5/c1-22(2)11-10-16-18(27-22)9-7-15(21(16)26-5)17(23)12-14-6-8-19(24-3)20(13-14)25-4/h6-11,13H,12H2,1-5H3 |
| InChIKey | TZRPLTHVBYHDBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SH-1242 (CHEBI:231663) has role angiogenesis inhibitor (CHEBI:48422) |
| SH-1242 (CHEBI:231663) has role antineoplastic agent (CHEBI:35610) |
| SH-1242 (CHEBI:231663) has role apoptosis inducer (CHEBI:68495) |
| SH-1242 (CHEBI:231663) has role Hsp90 inhibitor (CHEBI:63962) |
| SH-1242 (CHEBI:231663) is a aromatic ether (CHEBI:35618) |
| SH-1242 (CHEBI:231663) is a aromatic ketone (CHEBI:76224) |
| SH-1242 (CHEBI:231663) is a chromenes (CHEBI:23232) |
| SH-1242 (CHEBI:231663) is a dimethoxybenzene (CHEBI:51681) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-1-(5-methoxy-2,2-dimethyl-2H-chromen-6-yl)ethanone |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)-1-(5-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)ethan-1-one | IUPAC |
| SH 1242 | ChEBI |
| SH1242 | ChEBI |
| Citations |
|---|