EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O5 |
| Net Charge | 0 |
| Average Mass | 382.456 |
| Monoisotopic Mass | 382.17802 |
| SMILES | COc1ccc([C@H](C)C(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)cc1OC |
| InChI | InChI=1S/C23H26O5/c1-14(15-7-9-19(25-4)20(13-15)26-5)21(24)17-8-10-18-16(22(17)27-6)11-12-23(2,3)28-18/h7-14H,1-6H3/t14-/m0/s1 |
| InChIKey | GUQCQOSQMZKFIE-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SH-1280 (CHEBI:231662) has role Hsp90 inhibitor (CHEBI:63962) |
| SH-1280 (CHEBI:231662) is a aromatic ether (CHEBI:35618) |
| SH-1280 (CHEBI:231662) is a aromatic ketone (CHEBI:76224) |
| SH-1280 (CHEBI:231662) is a chromenes (CHEBI:23232) |
| SH-1280 (CHEBI:231662) is a dimethoxybenzene (CHEBI:51681) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dimethoxyphenyl)-1-(5-methoxy-2,2-dimethyl-2H-chromen-6-yl)propan-1-one |
| Synonyms | Source |
|---|---|
| (2S)-2-(3,4-dimethoxyphenyl)-1-(5-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)propan-1-one | IUPAC |
| SH1280 | ChEBI |
| SH 1280 | ChEBI |
| Citations |
|---|