EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 341.794 |
| Monoisotopic Mass | 341.08187 |
| SMILES | O=C(O)c1cnc2cc(Cl)c(-c3ccc(C4(O)CCC4)cc3)cc12 |
| InChI | InChI=1S/C19H16ClNO3/c20-16-9-17-14(15(10-21-17)18(22)23)8-13(16)11-2-4-12(5-3-11)19(24)6-1-7-19/h2-5,8-10,21,24H,1,6-7H2,(H,22,23) |
| InChIKey | FHQXLWCFSUSXBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator Any compound that binds to and activates the enzyme [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase (EC 2.7.11.31). |
| Applications: | nephroprotective agent Any protective agent that is able to prevent damage to the kidney. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-06409577 (CHEBI:231658) has role antiatherosclerotic agent (CHEBI:145947) |
| PF-06409577 (CHEBI:231658) has role antineoplastic agent (CHEBI:35610) |
| PF-06409577 (CHEBI:231658) has role EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator (CHEBI:85053) |
| PF-06409577 (CHEBI:231658) has role nephroprotective agent (CHEBI:76595) |
| PF-06409577 (CHEBI:231658) is a benzenes (CHEBI:22712) |
| PF-06409577 (CHEBI:231658) is a chloroindole (CHEBI:52508) |
| PF-06409577 (CHEBI:231658) is a cyclobutanes (CHEBI:156473) |
| PF-06409577 (CHEBI:231658) is a indolecarboxylic acid (CHEBI:38610) |
| PF-06409577 (CHEBI:231658) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 6-chloro-5-[4-(1-hydroxycyclobutyl)phenyl]-1H-indole-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-chloro-5-(4-(1-hydroxycyclobutyl)phenyl)-1H-indole-3-carboxylic acid | SUBMITTER |
| PF 06409577 | SUBMITTER |
| PF06409577 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6VT | PDBeChem |
| HMDB0244646 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1467057-23-3 | SUBMITTER |
| Citations |
|---|