EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 341.794 |
| Monoisotopic Mass | 341.08187 |
| SMILES | O=C(O)c1cnc2cc(Cl)c(-c3ccc(C4(O)CCC4)cc3)cc12 |
| InChI | InChI=1S/C19H16ClNO3/c20-16-9-17-14(15(10-21-17)18(22)23)8-13(16)11-2-4-12(5-3-11)19(24)6-1-7-19/h2-5,8-10,21,24H,1,6-7H2,(H,22,23) |
| InChIKey | FHQXLWCFSUSXBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator Any compound that binds to and activates the enzyme [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase (EC 2.7.11.31). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-06409577 (CHEBI:231658) has role antiatherosclerotic agent (CHEBI:145947) |
| PF-06409577 (CHEBI:231658) has role antineoplastic agent (CHEBI:35610) |
| PF-06409577 (CHEBI:231658) has role EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator (CHEBI:85053) |
| PF-06409577 (CHEBI:231658) has role nephroprotective agent (CHEBI:76595) |
| PF-06409577 (CHEBI:231658) is a benzenes (CHEBI:22712) |
| PF-06409577 (CHEBI:231658) is a chloroindole (CHEBI:52508) |
| PF-06409577 (CHEBI:231658) is a cyclobutanes (CHEBI:156473) |
| PF-06409577 (CHEBI:231658) is a indolecarboxylic acid (CHEBI:38610) |
| PF-06409577 (CHEBI:231658) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 6-chloro-5-[4-(1-hydroxycyclobutyl)phenyl]-1H-indole-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-chloro-5-(4-(1-hydroxycyclobutyl)phenyl)-1H-indole-3-carboxylic acid | SUBMITTER |
| PF 06409577 | SUBMITTER |
| PF06409577 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6VT | PDBeChem |
| HMDB0244646 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1467057-23-3 | SUBMITTER |
| Citations |
|---|