EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18OS |
| Net Charge | 0 |
| Average Mass | 162.298 |
| Monoisotopic Mass | 162.10784 |
| SMILES | CCCCC(S)CCCO |
| InChI | InChI=1S/C8H18OS/c1-2-3-5-8(10)6-4-7-9/h8-10H,2-7H2,1H3 |
| InChIKey | JANHCJQUCRCVOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-sulfanyloctan-1-ol (CHEBI:231656) has parent hydride octane (CHEBI:17590) |
| 4-sulfanyloctan-1-ol (CHEBI:231656) has role flavouring agent (CHEBI:35617) |
| 4-sulfanyloctan-1-ol (CHEBI:231656) is a alkanethiol (CHEBI:47908) |
| 4-sulfanyloctan-1-ol (CHEBI:231656) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 4-sulfanyloctan-1-ol |
| Synonyms | Source |
|---|---|
| 4-mercaptooctan-1-ol | IUPAC |
| FEMA 4983 | ChEBI |
| 4-mercapto-1-octanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| JP7154719 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:2491702-14-6 | ChEBI |