EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O |
| Net Charge | 0 |
| Average Mass | 166.264 |
| Monoisotopic Mass | 166.13577 |
| SMILES | C=C(CCC=C(C)C)CC(C)=O |
| InChI | InChI=1S/C11H18O/c1-9(2)6-5-7-10(3)8-11(4)12/h6H,3,5,7-8H2,1-2,4H3 |
| InChIKey | KXTWSEZAPOBUBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-methyl-4-methylidenenon-7-en-2-one (CHEBI:231655) has role flavouring agent (CHEBI:35617) |
| 8-methyl-4-methylidenenon-7-en-2-one (CHEBI:231655) is a methyl ketone (CHEBI:51867) |
| 8-methyl-4-methylidenenon-7-en-2-one (CHEBI:231655) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 8-methyl-4-methylidenenon-7-en-2-one |
| Synonyms | Source |
|---|---|
| 8-methyl-4-methylene-7-nonen-2-one | ChEBI |
| 8-methyl-4-methylenenon-7-en-2-one | ChEBI |
| FEMA 4981 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:6820-02-6 | ChEBI |