EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N2O2 |
| Net Charge | +1 |
| Average Mass | 309.389 |
| Monoisotopic Mass | 309.15975 |
| SMILES | [H][C@@]12C[C@@H]3[NH+](CC[C@]34C(=C1C=O)Nc1ccccc14)C/C2=C/CO |
| InChI | InChI=1S/C19H20N2O2/c22-8-5-12-10-21-7-6-19-15-3-1-2-4-16(15)20-18(19)14(11-23)13(12)9-17(19)21/h1-5,11,13,17,20,22H,6-10H2/p+1/b12-5-/t13-,17-,19+/m0/s1 |
| InChIKey | AMUXRBXLNYRDMU-YUUFOEQDSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxynorfluorocurarine (CHEBI:231652) is a aldehyde (CHEBI:17478) |
| 18-hydroxynorfluorocurarine (CHEBI:231652) is a ammonium ion derivative (CHEBI:35274) |
| 18-hydroxynorfluorocurarine (CHEBI:231652) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| 18-hydroxynorfluorocurarine (CHEBI:231652) is a organic heteropentacyclic compound (CHEBI:38164) |
| Synonyms | Source |
|---|---|
| 18-hydroxy-norfluorocurarine | SUBMITTER |
| 18-OH norfluorocurarine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 18-hydroxynorfluorocurarine | UniProt |
| Citations |
|---|