EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N2O |
| Net Charge | +1 |
| Average Mass | 293.390 |
| Monoisotopic Mass | 293.16484 |
| SMILES | [H][C@@]12C[C@@H]3[NH+](CC[C@]34C(=C1C=O)Nc1ccccc14)C/C2=C/C |
| InChI | InChI=1S/C19H20N2O/c1-2-12-10-21-8-7-19-15-5-3-4-6-16(15)20-18(19)14(11-22)13(12)9-17(19)21/h2-6,11,13,17,20H,7-10H2,1H3/p+1/b12-2-/t13-,17-,19+/m0/s1 |
| InChIKey | VFUITWPFKLGEQA-UQZDHWHBSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norfluorocurarine (CHEBI:231650) is a aldehyde (CHEBI:17478) |
| norfluorocurarine (CHEBI:231650) is a ammonium ion derivative (CHEBI:35274) |
| norfluorocurarine (CHEBI:231650) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| norfluorocurarine (CHEBI:231650) is a organic heteropentacyclic compound (CHEBI:38164) |
| UniProt Name | Source |
|---|---|
| norfluorocurarine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-24090 | MetaCyc |
| Citations |
|---|