EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H6BrCl2NO3S2 |
| Net Charge | 0 |
| Average Mass | 415.117 |
| Monoisotopic Mass | 412.83495 |
| SMILES | O=C(NS(=O)(=O)c1ccc(Br)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6BrCl2NO3S2/c12-9-3-4-10(19-9)20(17,18)15-11(16)7-2-1-6(13)5-8(7)14/h1-5H,(H,15,16) |
| InChIKey | WWONFUQGBVOKOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasisulam (CHEBI:231621) has role angiogenesis inhibitor (CHEBI:48422) |
| tasisulam (CHEBI:231621) has role antineoplastic agent (CHEBI:35610) |
| tasisulam (CHEBI:231621) has role apoptosis inducer (CHEBI:68495) |
| tasisulam (CHEBI:231621) is a N-sulfonylcarboxamide (CHEBI:90852) |
| tasisulam (CHEBI:231621) is a dichlorobenzene (CHEBI:23697) |
| tasisulam (CHEBI:231621) is a organobromine compound (CHEBI:37141) |
| tasisulam (CHEBI:231621) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-[(5-bromothiophen-2-yl)sulfonyl]-2,4-dichlorobenzamide |
| INNs | Source |
|---|---|
| tasisulam | WHO MedNet |
| tasisulam | WHO MedNet |
| tasisulam | WHO MedNet |
| tasisulamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-(2,4-dichlorobenzoyl)-5-bromothiophene-2-sulfonamide | SUBMITTER |
| N-(5-bromothiophen-2-yl)sulfonyl-2,4-dichlorobenzamide | SUBMITTER |
| LY 573636 | ChEBI |
| LY-573636 | ChEBI |
| LY573636 | ChEBI |
| Citations |
|---|