EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N6O3S2 |
| Net Charge | 0 |
| Average Mass | 416.488 |
| Monoisotopic Mass | 416.07253 |
| SMILES | CN1C(=O)c2sccc2N(C)c2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc21 |
| InChI | InChI=1S/C17H16N6O3S2/c1-22-12-7-8-27-14(12)16(24)23(2)13-9-19-17(21-15(13)22)20-10-3-5-11(6-4-10)28(18,25)26/h3-9H,1-2H3,(H2,18,25,26)(H,19,20,21) |
| InChIKey | YRDHKIFCGOZTGD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. cardioprotective agent Any protective agent that is able to prevent damage to the heart. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XMU-MP-1 (CHEBI:231615) has role bone density conservation agent (CHEBI:50646) |
| XMU-MP-1 (CHEBI:231615) has role cardioprotective agent (CHEBI:77307) |
| XMU-MP-1 (CHEBI:231615) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| XMU-MP-1 (CHEBI:231615) has role hepatoprotective agent (CHEBI:62868) |
| XMU-MP-1 (CHEBI:231615) is a organic heterotricyclic compound (CHEBI:26979) |
| XMU-MP-1 (CHEBI:231615) is a secondary amino compound (CHEBI:50995) |
| XMU-MP-1 (CHEBI:231615) is a sulfonamide (CHEBI:35358) |
| XMU-MP-1 (CHEBI:231615) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-[(5,10-dimethyl-6-oxo-6,10-dihydro-5H-pyrimido[5,4-b]thieno[3,2-e][1,4]diazepin-2-yl)amino]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-((5,10-dimethyl-6-oxo-6,10-dihydro-5H-pyrimido[5,4-b]thieno[3,2-e][1,4]diazepin-2-yl)amino)benzenesulfonamide | SUBMITTER |
| XMU MP 1 | ChEBI |
| XMU-MP1 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:2061980-01-4 | SUBMITTER |
| Citations |
|---|