EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23Cl2N5O3S |
| Net Charge | 0 |
| Average Mass | 556.475 |
| Monoisotopic Mass | 555.08987 |
| SMILES | Cc1c(C(=O)NN2CCS(=O)(=O)CC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCC#N)cc1 |
| InChI | InChI=1S/C26H23Cl2N5O3S/c1-18-24(26(34)31-32-13-15-37(35,36)16-14-32)30-33(23-11-10-21(27)17-22(23)28)25(18)20-8-6-19(7-9-20)5-3-2-4-12-29/h6-11,17H,2,4,13-16H2,1H3,(H,31,34) |
| InChIKey | XBHQLFVDGLPBCK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB1 receptor antagonist An antagonist that binds to and deactivates type 1 cannabinoid receptors. anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AM6545 (CHEBI:231613) has role anti-obesity agent (CHEBI:74518) |
| AM6545 (CHEBI:231613) has role appetite depressant (CHEBI:50507) |
| AM6545 (CHEBI:231613) has role CB1 receptor antagonist (CHEBI:73416) |
| AM6545 (CHEBI:231613) is a arylacetylene (CHEBI:51929) |
| AM6545 (CHEBI:231613) is a carbohydrazide (CHEBI:35363) |
| AM6545 (CHEBI:231613) is a dichlorobenzene (CHEBI:23697) |
| AM6545 (CHEBI:231613) is a nitrile (CHEBI:18379) |
| AM6545 (CHEBI:231613) is a pyrazoles (CHEBI:26410) |
| AM6545 (CHEBI:231613) is a sulfone (CHEBI:35850) |
| AM6545 (CHEBI:231613) is a thiomorpholines (CHEBI:36393) |
| IUPAC Name |
|---|
| 5-[4-(4-cyanobut-1-yn-1-yl)phenyl]-1-(2,4-dichlorophenyl)-N-(1,1-dioxidothiomorpholin-4-yl)-4-methyl-1H-pyrazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| 5-[4-(4-cyanobut-1-yn-1-yl)phenyl]-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1λ6,4-thiazinan-4-yl)-4-methyl-1H-pyrazole-3-carboxamide | SUBMITTER |
| 5-[4-(4-cyanobut-1-yn-1-yl)phenyl]-1-(2,4-dichlorophenyl)-N-(1,1-dioxo-1λ6-thiomorpholin-4-yl)-4-methyl-1H-pyrazole-3-carboxamide | ChEBI |
| AM 6545 | SUBMITTER |
| AM-6545 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| AM-6545 | Wikipedia |
| HMDB0248271 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1245626-05-4 | SUBMITTER |
| Citations |
|---|