EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18N2O3 |
| Net Charge | 0 |
| Average Mass | 346.386 |
| Monoisotopic Mass | 346.13174 |
| SMILES | CCc1oc2ccc(-c3cnn(C)c3)cc2c1C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H18N2O3/c1-3-18-20(21(25)13-4-7-16(24)8-5-13)17-10-14(6-9-19(17)26-18)15-11-22-23(2)12-15/h4-12,24H,3H2,1-2H3 |
| InChIKey | RHWADIJMDAZXJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DS-1-38 (CHEBI:231606) has role antineoplastic agent (CHEBI:35610) |
| DS-1-38 (CHEBI:231606) is a 1-benzofurans (CHEBI:38830) |
| DS-1-38 (CHEBI:231606) is a aromatic ketone (CHEBI:76224) |
| DS-1-38 (CHEBI:231606) is a phenols (CHEBI:33853) |
| DS-1-38 (CHEBI:231606) is a pyrazoles (CHEBI:26410) |
| DS-1-38 (CHEBI:231606) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| [2-ethyl-5-(1-methyl-1H-pyrazol-4-yl)-1-benzofuran-3-yl](4-hydroxyphenyl)methanone |
| Synonym | Source |
|---|---|
| DS38 | ChEBI |
| Citations |
|---|