EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24F3N7O3S |
| Net Charge | 0 |
| Average Mass | 571.585 |
| Monoisotopic Mass | 571.16134 |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3ccccn3)s2)nn1 |
| InChI | InChI=1S/C26H24F3N7O3S/c27-26(28,29)39-20-9-5-6-17(14-20)15-22(37)31-21-12-11-18(33-34-21)7-1-2-10-24-35-36-25(40-24)32-23(38)16-19-8-3-4-13-30-19/h3-6,8-9,11-14H,1-2,7,10,15-16H2,(H,31,34,37)(H,32,36,38) |
| InChIKey | PRAAPINBUWJLGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.2 (glutaminase) inhibitor Any EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the activity of a glutaminase (EC 3.5.1.2) and thus the generation of glutamate from glutamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telaglenastat (CHEBI:231605) has role EC 3.5.1.2 (glutaminase) inhibitor (CHEBI:60280) |
| telaglenastat (CHEBI:231605) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| telaglenastat | WHO MedNet |
| telaglenastat | WHO MedNet |
| télaglénastat | WHO MedNet |
| telaglenastatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(pyridin-2-yl)-N-(5-(4-(6-(2-(3-(trifluoromethoxy)phenyl)acetamido)pyridazin-3-yl)butyl)-1,3,4-thiadiazol-2-yl)acetamide | SUBMITTER |
| CB-839 | DrugBank |
| N-[6-[4-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 63J | PDBeChem |
| D11738 | KEGG DRUG |
| DB15232 | DrugBank |
| HMDB0249712 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1439399-58-2 | KEGG DRUG |
| Citations |
|---|