EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:231600 - erteberel
| Formula | C18H18O3 |
| Net Charge | 0 |
| Average Mass | 282.339 |
| Monoisotopic Mass | 282.12559 |
| SMILES | [H][C@]12CCC[C@@]1([H])c1cc(O)ccc1O[C@@]2([H])c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O3/c19-12-6-4-11(5-7-12)18-15-3-1-2-14(15)16-10-13(20)8-9-17(16)21-18/h4-10,14-15,18-20H,1-3H2/t14-,15+,18+/m1/s1 |
| InChIKey | XIESSJVMWNJCGZ-VKJFTORMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor agonist An agonist at the estrogen receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erteberel (CHEBI:231600) has role antineoplastic agent (CHEBI:35610) |
| erteberel (CHEBI:231600) has role apoptosis inducer (CHEBI:68495) |
| erteberel (CHEBI:231600) has role estrogen receptor agonist (CHEBI:63951) |
| erteberel (CHEBI:231600) is a diol (CHEBI:23824) |
| erteberel (CHEBI:231600) is a organic heterotricyclic compound (CHEBI:26979) |
| erteberel (CHEBI:231600) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (3aS,4R,9bR)-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
| INNs | Source |
|---|---|
| ertébérel | WHO MedNet |
| erteberel | WHO MedNet |
| erteberelum | WHO MedNet |
| erteberel | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY 500307 | DrugBank |
| SERBA-1 | DrugBank |
| LY-500307 | DrugBank |
| LY500307 | DrugBank |
| (3aS,4R,9bR)-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrobenzo[b]cyclopenta[d]pyran-8-ol | IUPAC |
| (3aS,4R,9bR)-1,2,3,3a,4,9b-hexahydro-4-(4-hydroxyphenyl)cyclopenta[c][1]benzopyran-8-ol | ChEBI |
| Citations |
|---|