EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | CC1=CCC(C(C)C)[C@@]12CCC1(C)C3CCC(C)C3C12 |
| InChI | InChI=1S/C20H32/c1-12(2)15-9-7-14(4)20(15)11-10-19(5)16-8-6-13(3)17(16)18(19)20/h7,12-13,15-18H,6,8-11H2,1-5H3/t13?,15?,16?,17?,18?,19?,20-/m1/s1 |
| InChIKey | XYWGRUBLFUSOOL-GFLGXMSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus luchuensis (ncbitaxon:1069201) | - | PubMed (37962519) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiroluchuene B (CHEBI:231563) has role fungal metabolite (CHEBI:76946) |
| spiroluchuene B (CHEBI:231563) is a diterpene (CHEBI:35190) |
| spiroluchuene B (CHEBI:231563) is a polycyclic olefin (CHEBI:35714) |
| spiroluchuene B (CHEBI:231563) is a tetracyclic diterpenoid (CHEBI:52557) |
| Citations |
|---|