EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:231541 - potassium hexachloroniobate(1−)
| Formula | Cl6Nb.K |
| Net Charge | 0 |
| Average Mass | 344.722 |
| Monoisotopic Mass | 341.68320 |
| SMILES | [Cl][Nb-]([Cl])([Cl])([Cl])([Cl])[Cl].[K+] |
| InChI | InChI=1S/6ClH.K.Nb/h6*1H;;/q;;;;;;+1;+5/p-6 |
| InChIKey | GCHPLIDUVOJGPP-UHFFFAOYSA-H |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium hexachloroniobate(1−) (CHEBI:231541) has role NMR chemical shift reference compound (CHEBI:228364) |
| potassium hexachloroniobate(1−) (CHEBI:231541) is a inorganic chloride (CHEBI:36093) |
| potassium hexachloroniobate(1−) (CHEBI:231541) is a niobium molecular entity (CHEBI:37221) |
| potassium hexachloroniobate(1−) (CHEBI:231541) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium hexachloroniobate(1−) |
| Synonyms | Source |
|---|---|
| KNbCl6 | ChEBI |
| K[NbCl6] | ChEBI |
| Citations |
|---|