EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4D12Si |
| Net Charge | 0 |
| Average Mass | 100.299 |
| Monoisotopic Mass | 100.14615 |
| SMILES | [2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H12Si/c1-5(2,3)4/h1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | CZDYPVPMEAXLPK-MGKWXGLJSA-N |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethylsilane-d12 (CHEBI:231529) has role NMR chemical shift reference compound (CHEBI:228364) |
| tetramethylsilane-d12 (CHEBI:231529) is a deuterated compound (CHEBI:76107) |
| tetramethylsilane-d12 (CHEBI:231529) is a organosilicon compound (CHEBI:25713) |
| IUPAC Name |
|---|
| tetrakis[(2H3)methyl]silane |
| Synonyms | Source |
|---|---|
| (CD3)4Si | ChEBI |
| tetrakis(trideuteriomethyl)silane | ChEBI |
| tetrakis(trideuteromethyl)silane | ChEBI |
| tetra(methyl-d3)silane | ChEBI |
| tetramethylsilane (TMS)-d12 | ChEBI |
| tetra(2H3)methylsilane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:18145-38-5 | ChEBI |