EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O |
| Net Charge | 0 |
| Average Mass | 134.178 |
| Monoisotopic Mass | 134.07316 |
| SMILES | [H]C(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H10O/c1-7-3-8(2)5-9(4-7)6-10/h3-6H,1-2H3 |
| InChIKey | NBEFMISJJNGCIZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea arabica (ncbitaxon:13443) | - | DOI (10.1016/j.lwt.2023.115675) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (29395956) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethylbenzaldehyde (CHEBI:231520) has role human metabolite (CHEBI:77746) |
| 3,5-dimethylbenzaldehyde (CHEBI:231520) has role plant metabolite (CHEBI:76924) |
| 3,5-dimethylbenzaldehyde (CHEBI:231520) is a benzaldehydes (CHEBI:22698) |
| 3,5-dimethylbenzaldehyde (CHEBI:231520) is a methylbenzene (CHEBI:38975) |
| IUPAC Name |
|---|
| 3,5-dimethylbenzaldehyde |
| Synonym | Source |
|---|---|
| m-xylene-5-carboxaldehyde | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,5-dimethylbenzaldehyde | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2038840 | Reaxys |
| CAS:5779-95-3 | NIST Chemistry WebBook |
| Citations |
|---|