EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O |
| Net Charge | 0 |
| Average Mass | 136.194 |
| Monoisotopic Mass | 136.08882 |
| SMILES | Cc1cc(C)cc(CO)c1 |
| InChI | InChI=1S/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 |
| InChIKey | IQWWTJDRVBWBEL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula hermonis (ncbitaxon:662815) | Root (BTO:0001188) | PubMed (31380416) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethylbenzyl alcohol (CHEBI:231518) has role plant metabolite (CHEBI:76924) |
| 3,5-dimethylbenzyl alcohol (CHEBI:231518) is a aromatic primary alcohol (CHEBI:33857) |
| 3,5-dimethylbenzyl alcohol (CHEBI:231518) is a methylbenzyl alcohol (CHEBI:25281) |
| IUPAC Name |
|---|
| (3,5-dimethylphenyl)methanol |
| Synonyms | Source |
|---|---|
| 3,5-dimethylbenzenemethanol | ChEBI |
| 1-(hydroxymethyl)-3,5-dimethylbenzene | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,5-dimethylbenzyl alcohol | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:27129-87-9 | NIST Chemistry WebBook |
| Citations |
|---|